EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34O9 |
| Net Charge | 0 |
| Average Mass | 514.571 |
| Monoisotopic Mass | 514.22028 |
| SMILES | C/C=C(/C)C(=O)O[C@H]1c2cc(OC)c(OC)c(OC)c2-c2c(cc3c(c2OC)OCO3)C[C@H](C)[C@]1(C)O |
| InChI | InChI=1S/C28H34O9/c1-9-14(2)27(29)37-26-17-12-18(31-5)22(32-6)25(34-8)21(17)20-16(10-15(3)28(26,4)30)11-19-23(24(20)33-7)36-13-35-19/h9,11-12,15,26,30H,10,13H2,1-8H3/b14-9-/t15-,26-,28-/m0/s1 |
| InChIKey | BKGUPIVDQHHVMV-RZGKOBFOSA-N |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gomisin B (CHEBI:81352) is a tannin (CHEBI:26848) |
| Synonym | Source |
|---|---|
| Schisantherin B | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17814 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:58546-55-7 | KEGG COMPOUND |