EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O6 |
| Net Charge | 0 |
| Average Mass | 300.266 |
| Monoisotopic Mass | 300.06339 |
| SMILES | COc1cc(O)cc2c1C(=O)c1c(O)cc(CO)cc1C2=O |
| InChI | InChI=1S/C16H12O6/c1-22-12-5-8(18)4-10-14(12)16(21)13-9(15(10)20)2-7(6-17)3-11(13)19/h2-5,17-19H,6H2,1H3 |
| InChIKey | SNBGJGNOQURXCI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus amstelodami (ncbitaxon:5054) | - | PubMed (24986678) | Species also known as Eurotium amstelodami. |
| Talaromyces stipitatus (ncbitaxon:28564) | - | PubMed (28509846) | Strain: KUFA 0207 |
| Aspergillus iizukae (ncbitaxon:41901) | - | PubMed (30445748) | |
| Aspergillus chevalieri (ncbitaxon:182096) | - | PubMed (28586721) | Species also known as Eurotium chevalieri. Strain: KUFA 0006 |
| Roles Classification |
|---|
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. anti-obesity agent Any substance which is used to reduce or control weight. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| questinol (CHEBI:81349) has role Aspergillus metabolite (CHEBI:76956) |
| questinol (CHEBI:81349) has role anti-inflammatory agent (CHEBI:67079) |
| questinol (CHEBI:81349) has role anti-obesity agent (CHEBI:74518) |
| questinol (CHEBI:81349) has role marine metabolite (CHEBI:76507) |
| questinol (CHEBI:81349) is a aromatic ether (CHEBI:35618) |
| questinol (CHEBI:81349) is a dihydroxyanthraquinone (CHEBI:37484) |
| questinol (CHEBI:81349) is conjugate acid of questinol(1−) (CHEBI:234006) |
| Incoming Relation(s) |
| questinol(1−) (CHEBI:234006) is conjugate base of questinol (CHEBI:81349) |
| IUPAC Name |
|---|
| 1,6-dihydroxy-3-(hydroxymethyl)-8-methoxyanthracene-9,10-dione |
| Synonym | Source |
|---|---|
| 1,6-dihydroxy-3-(hydroxymethyl)-8-methoxy-9,10-anthracenedione | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17811 | KEGG COMPOUND |
| HMDB0034443 | HMDB |
| FDB012850 | FooDB |
| C00057365 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| CAS:35688-09-6 | KEGG COMPOUND |
| Citations |
|---|