EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O9 |
| Net Charge | 0 |
| Average Mass | 418.398 |
| Monoisotopic Mass | 418.12638 |
| SMILES | Cc1cc2oc3cc(O)cc(O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)c3c(=O)c2cc1C |
| InChI | InChI=1S/C21H22O9/c1-8-3-11-12(4-9(8)2)28-13-5-10(23)6-14(16(13)17(11)24)29-21-20(27)19(26)18(25)15(7-22)30-21/h3-6,15,18-23,25-27H,7H2,1-2H3/t15-,18-,19+,20-,21-/m1/s1 |
| InChIKey | WMAOOSUVFZELAH-CMWLGVBASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fallopia multiflora (ncbitaxon:76025) | root (BTO:0001188) | PubMed (16564530) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| polygonimitin B (CHEBI:81347) has role plant metabolite (CHEBI:76924) |
| polygonimitin B (CHEBI:81347) is a monosaccharide derivative (CHEBI:63367) |
| polygonimitin B (CHEBI:81347) is a phenols (CHEBI:33853) |
| polygonimitin B (CHEBI:81347) is a xanthone glycoside (CHEBI:83231) |
| polygonimitin B (CHEBI:81347) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 3-hydroxy-6,7-dimethyl-9-oxo-9H-xanthen-1-yl β-D-glucopyranoside |
| Manual Xrefs | Databases |
|---|---|
| C17809 | KEGG COMPOUND |
| Citations |
|---|