EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O8 |
| Net Charge | 0 |
| Average Mass | 360.318 |
| Monoisotopic Mass | 360.08452 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)c(OC)c(OC)cc3o2)c(O)cc1O |
| InChI | InChI=1S/C18H16O8/c1-23-13-4-8(9(19)5-10(13)20)12-6-11(21)16-14(26-12)7-15(24-2)18(25-3)17(16)22/h4-7,19-20,22H,1-3H3 |
| InChIKey | IZWKTABKAJGBFW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Artemisia capillaris (ncbitaxon:265783) | - | PubMed (23435948) |
| Roles Classification |
|---|
| Biological Roles: | EC 3.2.1.20 (alpha-glucosidase) inhibitor An EC 3.2.1.* (glycosidase) inhibitor that interferes with the action of α-glucosidase (EC 3.2.1.20). EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor An EC 3.1.3.* (phosphoric monoester hydrolase) inhibitor which interferes with the activity of the enzyme protein tyrosine phosphatases (PTPs), EC 3.1.3.48, involved in the removal of phosphate groups from phosphorylated tyrosine residues on proteins. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| arcapillin (CHEBI:81339) has functional parent flavone (CHEBI:42491) |
| arcapillin (CHEBI:81339) has role EC 3.1.3.48 (protein-tyrosine-phosphatase) inhibitor (CHEBI:35608) |
| arcapillin (CHEBI:81339) has role EC 3.2.1.20 (α-glucosidase) inhibitor (CHEBI:67239) |
| arcapillin (CHEBI:81339) has role plant metabolite (CHEBI:76924) |
| arcapillin (CHEBI:81339) is a trihydroxyflavone (CHEBI:27116) |
| arcapillin (CHEBI:81339) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 2-(2,4-dihydroxy-5-methoxyphenyl)-5-hydroxy-6,7-dimethoxy-4H-1-benzopyran-4-one |
| Synonym | Source |
|---|---|
| 2',4',5-trihydroxy-5',6,7-trimethoxyflavone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Arcapillin | Wikipedia |
| C00003938 | KNApSAcK |
| C17787 | KEGG COMPOUND |
| LMPK12111282 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6074920 | Reaxys |
| CAS:83162-82-7 | ChemIDplus |
| CAS:83162-82-7 | KEGG COMPOUND |
| Citations |
|---|