EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16N2O8 |
| Net Charge | 0 |
| Average Mass | 388.332 |
| Monoisotopic Mass | 388.09067 |
| SMILES | O=C(O)C1=C/C(=C/C=N\[C@@H](CC2=CC(=O)C(=O)C=C2)C(=O)O)C[C@@H](C(=O)O)N1 |
| InChI | InChI=1S/C18H16N2O8/c21-14-2-1-9(8-15(14)22)5-11(16(23)24)19-4-3-10-6-12(17(25)26)20-13(7-10)18(27)28/h1-4,6,8,11,13,20H,5,7H2,(H,23,24)(H,25,26)(H,27,28)/b10-3-,19-4-/t11-,13-/m0/s1 |
| InChIKey | DVOFEZJSDVPRON-AFUNOPLTSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dopaxanthin quinone (CHEBI:81318) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Manual Xrefs | Databases |
|---|---|
| C17753 | KEGG COMPOUND |