EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O11 |
| Net Charge | 0 |
| Average Mass | 530.526 |
| Monoisotopic Mass | 530.17881 |
| SMILES | COc1cc(/C=C/C(O)=C/C(=O)/C=C/c2ccc(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(OC)c2)ccc1O |
| InChI | InChI=1S/C27H30O11/c1-35-21-11-15(5-9-19(21)31)3-7-17(29)13-18(30)8-4-16-6-10-20(22(12-16)36-2)37-27-26(34)25(33)24(32)23(14-28)38-27/h3-13,23-29,31-34H,14H2,1-2H3/b7-3+,8-4+,17-13-/t23-,24-,25+,26-,27-/m1/s1 |
| InChIKey | SHKKKJAZAXOQJJ-LVCGPBKYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Curcumin monoglucoside (CHEBI:81314) is a diarylheptanoid (CHEBI:78802) |
| Manual Xrefs | Databases |
|---|---|
| C17749 | KEGG COMPOUND |