EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20O3 |
| Net Charge | 0 |
| Average Mass | 260.333 |
| Monoisotopic Mass | 260.14124 |
| SMILES | CCCCC/C(O)=C/C(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C16H20O3/c1-2-3-4-5-15(18)12-16(19)11-8-13-6-9-14(17)10-7-13/h6-12,17-18H,2-5H2,1H3/b11-8+,15-12- |
| InChIKey | BWAVVEBSGHWPHL-QUHNVXOFSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-(4-Hydroxyphenyl)-1-decene-3,5-dione (CHEBI:81309) is a hydroxycinnamic acid (CHEBI:24689) |
| Manual Xrefs | Databases |
|---|---|
| C17744 | KEGG COMPOUND |