EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H48O5 |
| Net Charge | 0 |
| Average Mass | 512.731 |
| Monoisotopic Mass | 512.35017 |
| SMILES | [H][C@]12C(=O)C=C3[C@]4([H])C[C@@](C)(C(=O)O)CC[C@]4(C)CC[C@@]3(C)[C@]1(C)CC[C@@]1([H])C(C)(C)[C@@H](OC(C)=O)CC[C@]21C |
| InChI | InChI=1S/C32H48O5/c1-19(33)37-24-10-11-30(6)23(27(24,2)3)9-12-32(8)25(30)22(34)17-20-21-18-29(5,26(35)36)14-13-28(21,4)15-16-31(20,32)7/h17,21,23-25H,9-16,18H2,1-8H3,(H,35,36)/t21-,23-,24-,25+,28+,29-,30-,31+,32+/m0/s1 |
| InChIKey | FTQDJVZNPJRVPG-XWEVEMRCSA-N |
| Roles Classification |
|---|
| Application: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Acetoxolone (CHEBI:81306) has role anti-ulcer drug (CHEBI:49201) |
| Acetoxolone (CHEBI:81306) is a triterpenoid (CHEBI:36615) |
| Synonyms | Source |
|---|---|
| Acetoxolone | ChEMBL |
| acetylglycyrrhetic acid | DrugCentral |
| Acetylglycyrrhetinic acid | KEGG COMPOUND |
| DGS 0110A | ChEMBL |
| DGS-0110A | ChEMBL |
| glycyrrhetic acid acetate | DrugCentral |
| Citations |
|---|