EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H20N6O12 |
| Net Charge | 0 |
| Average Mass | 416.300 |
| Monoisotopic Mass | 416.11392 |
| SMILES | O=[N+]([O-])OCCN(CCO[N+](=O)[O-])CCN(CCO[N+](=O)[O-])CCO[N+](=O)[O-] |
| InChI | InChI=1S/C10H20N6O12/c17-13(18)25-7-3-11(4-8-26-14(19)20)1-2-12(5-9-27-15(21)22)6-10-28-16(23)24/h1-10H2 |
| InChIKey | DLDKCSIJFIPYRK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tenitramine (CHEBI:81292) has role cardiovascular drug (CHEBI:35554) |
| Tenitramine (CHEBI:81292) is a nitrate ester (CHEBI:51080) |
| Tenitramine (CHEBI:81292) is a nitrates (CHEBI:51081) |
| Tenitramine (CHEBI:81292) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| Tenitramine | ChEMBL |