EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O11 |
| Net Charge | 0 |
| Average Mass | 450.396 |
| Monoisotopic Mass | 450.11621 |
| SMILES | O=C1C[C@@H](c2ccc(O)cc2)Oc2cc(O)c(O)c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c21 |
| InChI | InChI=1S/C21H22O11/c22-7-14-17(27)18(28)19(29)21(31-14)32-20-15-10(24)5-12(8-1-3-9(23)4-2-8)30-13(15)6-11(25)16(20)26/h1-4,6,12,14,17-19,21-23,25-29H,5,7H2/t12-,14+,17+,18-,19+,21-/m0/s1 |
| InChIKey | UBFTZAGDGOMJQE-SACPXRHSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Carthamus tinctorius (ncbitaxon:4222) | flower (BTO:0000469) | PubMed (22723874) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| neocarthamin (CHEBI:81267) has functional parent carthamidin (CHEBI:80809) |
| neocarthamin (CHEBI:81267) has role plant metabolite (CHEBI:76924) |
| neocarthamin (CHEBI:81267) is a 4'-hydroxyflavanones (CHEBI:140331) |
| neocarthamin (CHEBI:81267) is a flavanone glycoside (CHEBI:72730) |
| neocarthamin (CHEBI:81267) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| (2S)-6,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-3,4-dihydro-2H-1-benzopyran-5-yl β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| carthamidin 5-O-β-glucoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C17675 | KEGG COMPOUND |
| HMDB0037476 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8371068 | Reaxys |
| Citations |
|---|