EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O5 |
| Net Charge | 0 |
| Average Mass | 258.229 |
| Monoisotopic Mass | 258.05282 |
| SMILES | Cc1cc(=O)c2c(O)c3c(O)cc(O)cc3cc2o1 |
| InChI | InChI=1S/C14H10O5/c1-6-2-9(16)13-11(19-6)4-7-3-8(15)5-10(17)12(7)14(13)18/h2-5,15,17-18H,1H3 |
| InChIKey | RVRLLYKHCMHGKV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cassia quinquangulata (IPNI:48961-2) | - | PubMed (11575947) | |
| Cassia tora (ncbitaxon:362788) | seed (BTO:0001226) | Article (Book: Dictionary of Antibiotics and Related Substances: with CD-ROM, Second Edition, page 1749.) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| norrubrofusarin (CHEBI:81264) has role plant metabolite (CHEBI:76924) |
| norrubrofusarin (CHEBI:81264) is a benzochromenone (CHEBI:64986) |
| norrubrofusarin (CHEBI:81264) is a heptaketide (CHEBI:59872) |
| norrubrofusarin (CHEBI:81264) is a naphtho-γ-pyrone (CHEBI:64542) |
| norrubrofusarin (CHEBI:81264) is a phenols (CHEBI:33853) |
| norrubrofusarin (CHEBI:81264) is conjugate acid of norrubrofusarin(1−) (CHEBI:145839) |
| Incoming Relation(s) |
| norrubrofusarin(1−) (CHEBI:145839) is conjugate base of norrubrofusarin (CHEBI:81264) |
| IUPAC Name |
|---|
| 5,6,8-trihydroxy-2-methyl-4H-benzo[g]chromen-4-one |
| Synonyms | Source |
|---|---|
| 5,6,8-trihydroxy-2-methyl-4H-naphtho[2,3-b]pyran-4-one | IUPAC |
| nor-rubrofusarin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00030836 | KNApSAcK |
| C17671 | KEGG COMPOUND |
| CPD-18241 | MetaCyc |
| FDB012109 | FooDB |
| HMDB0033911 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:3566-98-1 | HMDB |
| Citations |
|---|