EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:81257 - 3-phenylpropyl acetate
| Formula | C11H14O2 |
| Net Charge | 0 |
| Average Mass | 178.231 |
| Monoisotopic Mass | 178.09938 |
| SMILES | CC(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C11H14O2/c1-10(12)13-9-5-8-11-6-3-2-4-7-11/h2-4,6-7H,5,8-9H2,1H3 |
| InChIKey | JRJGKUTZNBZHNK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-phenylpropyl acetate (CHEBI:81257) has role fragrance (CHEBI:48318) |
| 3-phenylpropyl acetate (CHEBI:81257) has role metabolite (CHEBI:25212) |
| 3-phenylpropyl acetate (CHEBI:81257) is a acetate ester (CHEBI:47622) |
| 3-phenylpropyl acetate (CHEBI:81257) is a benzenes (CHEBI:22712) |
| IUPAC Name |
|---|
| 3-phenylpropyl acetate |
| Citations |
|---|