EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H40O5 |
| Net Charge | 0 |
| Average Mass | 408.579 |
| Monoisotopic Mass | 408.28757 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)CCC(=O)O)[C@@]1(C)CC[C@]1([H])[C@@]3(C)CC[C@@H](O)C[C@@]3([H])[C@H](O)[C@@H](O)[C@@]21[H] |
| InChI | InChI=1S/C24H40O5/c1-13(4-7-19(26)27)15-5-6-16-20-17(9-11-23(15,16)2)24(3)10-8-14(25)12-18(24)21(28)22(20)29/h13-18,20-22,25,28-29H,4-12H2,1-3H3,(H,26,27)/t13-,14-,15-,16+,17+,18+,20+,21+,22+,23-,24-/m1/s1 |
| InChIKey | DKPMWHFRUGMUKF-GDYCBZMLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α-muricholic acid (CHEBI:81243) is a 6β-hydroxy steroid (CHEBI:36851) |
| α-muricholic acid (CHEBI:81243) is a 7α-hydroxy steroid (CHEBI:36843) |
| α-muricholic acid (CHEBI:81243) is a muricholic acids (CHEBI:134216) |
| α-muricholic acid (CHEBI:81243) is conjugate acid of α-muricholate (CHEBI:134116) |
| Incoming Relation(s) |
| alpha-muricholic acid-d5 (CHEBI:192788) is a α-muricholic acid (CHEBI:81243) |
| α-muricholate (CHEBI:134116) is conjugate base of α-muricholic acid (CHEBI:81243) |
| IUPAC Name |
|---|
| 3α,6β,7α-trihydroxy-5β-cholan-24-oic acid |
| Synonyms | Source |
|---|---|
| (3α,5β,6β,7α)-3,6,7-trihydroxycholan-24-oic acid | IUPAC |
| 5beta-Cholanic acid-3alpha,6beta,7alpha-triol | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17647 | KEGG COMPOUND |
| LMST04010066 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| CAS:2393-58-0 | KEGG COMPOUND |
| Citations |
|---|