EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C60H50O24 |
| Net Charge | 0 |
| Average Mass | 1155.036 |
| Monoisotopic Mass | 1154.26920 |
| SMILES | Oc1cc(O)c2c(c1)O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)[C@H]2c1c(O)cc(O)c2c1O[C@H](c1ccc(O)c(O)c1)[C@H](O)C2 |
| InChI | InChI=1S/C60H50O24/c61-23-13-34(71)42-41(14-23)81-55(20-2-6-26(63)31(68)10-20)51(78)48(42)44-36(73)17-38(75)46-50(53(80)57(83-59(44)46)22-4-8-28(65)33(70)12-22)47-39(76)18-37(74)45-49(52(79)56(84-60(45)47)21-3-7-27(64)32(69)11-21)43-35(72)16-29(66)24-15-40(77)54(82-58(24)43)19-1-5-25(62)30(67)9-19/h1-14,16-18,40,48-57,61-80H,15H2/t40-,48-,49+,50-,51-,52-,53-,54-,55-,56-,57-/m1/s1 |
| InChIKey | QFLMUASKTWGRQE-JNIIMKSASA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cinnamtannin A2 (CHEBI:81227) has role plant metabolite (CHEBI:76924) |
| cinnamtannin A2 (CHEBI:81227) is a proanthocyanidin (CHEBI:26267) |
| IUPAC Name |
|---|
| (12R,13R,14R,22R,23R,24R,32R,33R,34S,42R,43R)-12,22,32,42-tetrakis(3,4-dihydroxyphenyl)-13,14,23,24,33,34,43,44-octahydro-12H,22H,32H,422H-[14,28:24,38:34,48-quater-1-benzopyran]-13,15,17,23,25,27,33,35,37,43,45,47-dodecol |
| Manual Xrefs | Databases |
|---|---|
| C17625 | KEGG COMPOUND |
| HMDB0037661 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4780804 | Reaxys |
| Citations |
|---|