EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H15ClNO4PS2 |
| Net Charge | 0 |
| Average Mass | 367.816 |
| Monoisotopic Mass | 366.98686 |
| SMILES | CCOP(=S)(OCC)SCn1c(=O)oc2cc(Cl)ccc21 |
| InChI | InChI=1S/C12H15ClNO4PS2/c1-3-16-19(20,17-4-2)21-8-14-10-6-5-9(13)7-11(10)18-12(14)15/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | IOUNQDKNJZEDEP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). EC 3.1.1.7 (acetylcholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of enzyme acetylcholinesterase (EC 3.1.1.7), which helps breaking down of acetylcholine into choline and acetic acid. |
| Applications: | acaricide A substance used to destroy pests of the subclass Acari (mites and ticks). agrochemical An agrochemical is a substance that is used in agriculture or horticulture. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. pesticide Strictly, a substance intended to kill pests. In common usage, any substance used for controlling, preventing, or destroying animal, microbiological or plant pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phosalone (CHEBI:8121) has role acaricide (CHEBI:22153) |
| phosalone (CHEBI:8121) has role agrochemical (CHEBI:33286) |
| phosalone (CHEBI:8121) has role EC 3.1.1.7 (acetylcholinesterase) inhibitor (CHEBI:38462) |
| phosalone (CHEBI:8121) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| phosalone (CHEBI:8121) is a 1,3-benzoxazoles (CHEBI:51548) |
| phosalone (CHEBI:8121) is a carbamate ester (CHEBI:23003) |
| phosalone (CHEBI:8121) is a organochlorine insecticide (CHEBI:25705) |
| phosalone (CHEBI:8121) is a organothiophosphate insecticide (CHEBI:25715) |
| IUPAC Name |
|---|
| S-[(6-chloro-2-oxo-1,3-benzoxazol-3(2H)-yl)methyl] O,O-diethyl phosphorodithioate |
| Synonyms | Source |
|---|---|
| 3-[O,O-(Diethyldithiophosphoryl)methyl]-6-chlorobenzoxazolinone | NIST Chemistry WebBook |
| Agria 1060 A | KEGG COMPOUND |
| S-[(6-chloro-2-oxo-1,3-benzoxazol-3(2H)-yl)methyl] O,O-diethyl dithiophosphate | IUPAC |
| Phosalone | KEGG COMPOUND |
| Phosphorodithioic acid, S-((6-chloro-2-oxo-3(2H)-benzoxazolyl)methyl) O,O-diethyl ester | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 520 | PPDB |
| C11028 | KEGG COMPOUND |
| CA1048929 | Patent |
| HMDB0041985 | HMDB |
| JP2006213665 | Patent |
| LSM-25642 | LINCS |
| Phosalone | Wikipedia |
| Citations |
|---|