EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O15 |
| Net Charge | 0 |
| Average Mass | 594.522 |
| Monoisotopic Mass | 594.15847 |
| SMILES | C[C@@H]1O[C@@H](Oc2c(-c3ccc(O)cc3)oc3cc(O)cc(O)c3c2=O)[C@H](O)[C@H](O)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H30O15/c1-9-23(41-27-21(36)19(34)17(32)15(8-28)40-27)20(35)22(37)26(38-9)42-25-18(33)16-13(31)6-12(30)7-14(16)39-24(25)10-2-4-11(29)5-3-10/h2-7,9,15,17,19-23,26-32,34-37H,8H2,1H3/t9-,15+,17+,19-,20-,21+,22+,23-,26-,27-/m0/s1 |
| InChIKey | ZCSDEGFPWXFQLB-WRHRXROUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Moringa oleifera (ncbitaxon:3735) | leaf (BTO:0000713) | PubMed (24024688) | |
| Neocheiropteris palmatopedata (ncbitaxon:253767) | root (BTO:0001188) | PubMed (20100622) | |
| Rhodiola sachalinensis (ncbitaxon:265354) | root (BTO:0001188) | PubMed (23018923) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| multiflorin B (CHEBI:81208) has functional parent kaempferol (CHEBI:28499) |
| multiflorin B (CHEBI:81208) has role antioxidant (CHEBI:22586) |
| multiflorin B (CHEBI:81208) has role plant metabolite (CHEBI:76924) |
| multiflorin B (CHEBI:81208) is a disaccharide derivative (CHEBI:63353) |
| multiflorin B (CHEBI:81208) is a glycosyloxyflavone (CHEBI:50018) |
| multiflorin B (CHEBI:81208) is a trihydroxyflavone (CHEBI:27116) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-1-benzopyran-3-yl 6-deoxy-4-O-β-D-glucopyranosyl-α-L-mannopyranoside |
| Synonym | Source |
|---|---|
| kaempferol-3-O-α-L-rhamnopyranosyl-(1→4)-β-D-glucopyranoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C17600 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8465229 | Reaxys |
| CAS:52657-01-9 | ChemIDplus |
| Citations |
|---|