EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H30O16 |
| Net Charge | 0 |
| Average Mass | 610.521 |
| Monoisotopic Mass | 610.15338 |
| SMILES | C[C@@H]1O[C@@H](Oc2c(-c3ccc(O)c(O)c3)oc3cc(O)cc(O)c3c2=O)[C@H](O)[C@H](O)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C27H30O16/c1-8-23(42-27-21(37)19(35)17(33)15(7-28)41-27)20(36)22(38)26(39-8)43-25-18(34)16-13(32)5-10(29)6-14(16)40-24(25)9-2-3-11(30)12(31)4-9/h2-6,8,15,17,19-23,26-33,35-38H,7H2,1H3/t8-,15+,17+,19-,20-,21+,22+,23-,26-,27-/m0/s1 |
| InChIKey | CAENGMLSMONNBU-QLYOBGCHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Prunus tomentosa (ncbitaxon:105667) | seed (BTO:0001226) | PubMed (18449498) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| multinoside A (CHEBI:81186) has functional parent quercetin (CHEBI:16243) |
| multinoside A (CHEBI:81186) has role antioxidant (CHEBI:22586) |
| multinoside A (CHEBI:81186) has role plant metabolite (CHEBI:76924) |
| multinoside A (CHEBI:81186) is a disaccharide derivative (CHEBI:63353) |
| multinoside A (CHEBI:81186) is a glycosyloxyflavone (CHEBI:50018) |
| multinoside A (CHEBI:81186) is a tetrahydroxyflavone (CHEBI:38684) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-4H-1-benzopyran-3-yl 6-deoxy-4-O-β-D-glucopyranosyl-α-L-mannopyranoside |
| Synonym | Source |
|---|---|
| quercetin 3-glucosyl-(1→4)-rhamnoside | KNApSAcK |
| Manual Xrefs | Databases |
|---|---|
| C17563 | KEGG COMPOUND |
| HMDB0037935 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4285619 | Reaxys |
| Citations |
|---|