EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O12 |
| Net Charge | 0 |
| Average Mass | 466.395 |
| Monoisotopic Mass | 466.11113 |
| SMILES | O=C1C[C@@H](c2cc(O)c(O)c(O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c2)Oc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C21H22O12/c22-6-15-18(28)19(29)20(30)21(33-15)32-14-2-7(1-11(26)17(14)27)12-5-10(25)16-9(24)3-8(23)4-13(16)31-12/h1-4,12,15,18-24,26-30H,5-6H2/t12-,15+,18+,19-,20+,21+/m0/s1 |
| InChIKey | SNFFBROYEDWRGB-NHXQFOETSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Plantago asiatica (ncbitaxon:197796) | seed (BTO:0001226) | PubMed (2610694) | |
| Plantago major (ncbitaxon:29818) | seed (BTO:0001226) | PubMed (24895551) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| plantagoside (CHEBI:81163) has functional parent (2S)-flavanone (CHEBI:15606) |
| plantagoside (CHEBI:81163) has role plant metabolite (CHEBI:76924) |
| plantagoside (CHEBI:81163) is a 4'-hydroxyflavanones (CHEBI:140331) |
| plantagoside (CHEBI:81163) is a flavanone glycoside (CHEBI:72730) |
| plantagoside (CHEBI:81163) is a monosaccharide derivative (CHEBI:63367) |
| plantagoside (CHEBI:81163) is a tetrahydroxyflavanone (CHEBI:38742) |
| plantagoside (CHEBI:81163) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 5-[(2S)-5,7-dihydroxy-4-oxo-3,4-dihydro-2H-1-benzopyran-2-yl]-2,3-dihydroxyphenyl β-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 2'-O-β-glucopyranosyl-5,7,4',5'-tetrahydroxyflavanone | ChemIDplus |
| 5,7,4',5'-tetrahydroxyflavanone-3'-O-glucoside | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C17531 | KEGG COMPOUND |
| LMPK12140454 | LIPID MAPS |
| C00008343 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5670908 | Reaxys |
| CAS:78708-33-5 | KEGG COMPOUND |
| CAS:78708-33-5 | ChemIDplus |
| Citations |
|---|