EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N2O |
| Net Charge | 0 |
| Average Mass | 150.181 |
| Monoisotopic Mass | 150.07931 |
| SMILES | CNC(=O)c1ccccc1N |
| InChI | InChI=1S/C8H10N2O/c1-10-8(11)6-4-2-3-5-7(6)9/h2-5H,9H2,1H3,(H,10,11) |
| InChIKey | KIMWOULVHFLJIU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-Methylanthranilamide (CHEBI:81147) is a aminobenzoic acid (CHEBI:22495) |
| Synonym | Source |
|---|---|
| N-Methyl-2-aminobenzamide | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17512 | KEGG COMPOUND |