EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H18NO2 |
| Net Charge | +1 |
| Average Mass | 196.270 |
| Monoisotopic Mass | 196.13321 |
| SMILES | C[N+](C)(C)CCc1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H17NO2/c1-12(2,3)7-6-9-4-5-10(13)11(14)8-9/h4-5,8H,6-7H2,1-3H3,(H-,13,14)/p+1 |
| InChIKey | VDTBORSEFUUDTP-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Coryneine (CHEBI:81125) is a catecholamine (CHEBI:33567) |
| Manual Xrefs | Databases |
|---|---|
| C17486 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:7224-66-0 | KEGG COMPOUND |