EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O5 |
| Net Charge | 0 |
| Average Mass | 326.348 |
| Monoisotopic Mass | 326.11542 |
| SMILES | COc1ccc(Cc2coc3c(C)c(O)c(C)c(O)c3c2=O)cc1 |
| InChI | InChI=1S/C19H18O5/c1-10-16(20)11(2)19-15(17(10)21)18(22)13(9-24-19)8-12-4-6-14(23-3)7-5-12/h4-7,9,20-21H,8H2,1-3H3 |
| InChIKey | BUTFXZVBLOLETI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ophiopogon japonicus (ncbitaxon:100506) | - | Article (Studies on the liposoluble components from tuber of {\sl Ophiopogon japonicus} Zhongguo yao xue za zhi (Zhongguo yao xue hui : 1989) 40, 337-341) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methylophiopogonone B (CHEBI:81116) has role plant metabolite (CHEBI:76924) |
| methylophiopogonone B (CHEBI:81116) is a homoisoflavonoid (CHEBI:86008) |
| methylophiopogonone B (CHEBI:81116) is a monomethoxybenzene (CHEBI:25235) |
| methylophiopogonone B (CHEBI:81116) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-3-[(4-methoxyphenyl)methyl]-6,8-dimethyl-4H-1-benzopyran-4-one |
| Manual Xrefs | Databases |
|---|---|
| C17474 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5605476 | Reaxys |
| Citations |
|---|