EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32O7 |
| Net Charge | 0 |
| Average Mass | 456.535 |
| Monoisotopic Mass | 456.21480 |
| SMILES | C=C(C)C(CCC(C)(C)O)Cc1c(O)cc(OC)c(C(=O)/C=C/c2ccc(O)cc2O)c1O |
| InChI | InChI=1S/C26H32O7/c1-15(2)17(10-11-26(3,4)32)12-19-22(30)14-23(33-5)24(25(19)31)20(28)9-7-16-6-8-18(27)13-21(16)29/h6-9,13-14,17,27,29-32H,1,10-12H2,2-5H3/b9-7+ |
| InChIKey | YXLKVASXUULQJH-VQHVLOKHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sophora flavescens (ncbitaxon:49840) | - | PubMed (18175961) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kuraridinol (CHEBI:81094) has functional parent trans-chalcone (CHEBI:48965) |
| kuraridinol (CHEBI:81094) has role plant metabolite (CHEBI:76924) |
| kuraridinol (CHEBI:81094) is a chalcones (CHEBI:23086) |
| kuraridinol (CHEBI:81094) is a monomethoxybenzene (CHEBI:25235) |
| kuraridinol (CHEBI:81094) is a resorcinols (CHEBI:33572) |
| IUPAC Name |
|---|
| (2E)-1-{2,4-dihydroxy-3-[5-hydroxy-5-methyl-2-(prop-1-en-2-yl)hexyl]-6-methoxyphenyl}-3-(2,4-dihydroxyphenyl)prop-2-en-1-one |
| Manual Xrefs | Databases |
|---|---|
| C17445 | KEGG COMPOUND |
| LMPK12120283 | LIPID MAPS |
| C00007149 | KNApSAcK |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2492527 | Reaxys |
| Citations |
|---|