EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:81093 - kurarinol
| Formula | C26H32O7 |
| Net Charge | 0 |
| Average Mass | 456.535 |
| Monoisotopic Mass | 456.21480 |
| SMILES | C=C(C)[C@H](CCC(C)(C)O)Cc1c(O)cc(OC)c2c1O[C@H](c1ccc(O)cc1O)CC2=O |
| InChI | InChI=1S/C26H32O7/c1-14(2)15(8-9-26(3,4)31)10-18-20(29)12-23(32-5)24-21(30)13-22(33-25(18)24)17-7-6-16(27)11-19(17)28/h6-7,11-12,15,22,27-29,31H,1,8-10,13H2,2-5H3/t15-,22+/m1/s1 |
| InChIKey | XMUPAAIHKAIUSU-QRQCRPRQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sophora flavescens (ncbitaxon:49840) | root (BTO:0001188) | PubMed (17951038) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kurarinol (CHEBI:81093) has functional parent (2S)-flavanone (CHEBI:15606) |
| kurarinol (CHEBI:81093) has role anti-inflammatory agent (CHEBI:67079) |
| kurarinol (CHEBI:81093) has role antioxidant (CHEBI:22586) |
| kurarinol (CHEBI:81093) has role plant metabolite (CHEBI:76924) |
| kurarinol (CHEBI:81093) is a 4'-hydroxyflavanones (CHEBI:140331) |
| kurarinol (CHEBI:81093) is a monomethoxyflavanone (CHEBI:38738) |
| kurarinol (CHEBI:81093) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| (2S)-2-(2,4-dihydroxyphenyl)-7-hydroxy-8-[(2R)-5-hydroxy-5-methyl-2-(prop-1-en-2-yl)hexyl]-5-methoxy-2,3-dihydro-4H-1-benzopyran-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19204008 | Reaxys |
| CAS:855746-98-4 | ChemIDplus |
| Citations |
|---|