EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24N2O |
| Net Charge | 0 |
| Average Mass | 248.370 |
| Monoisotopic Mass | 248.18886 |
| SMILES | [H][C@]12CCCN3CCC[C@]([H])([C@]31[H])[C@@]1([H])CCCC(=O)N1C2 |
| InChI | InChI=1S/C15H24N2O/c18-14-7-1-6-13-12-5-3-9-16-8-2-4-11(15(12)16)10-17(13)14/h11-13,15H,1-10H2/t11-,12+,13-,15-/m1/s1 |
| InChIKey | ZSBXGIUJOOQZMP-QVHKTLOISA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isomatrine (CHEBI:81092) is a alkaloid (CHEBI:22315) |
| Manual Xrefs | Databases |
|---|---|
| C17442 | KEGG COMPOUND |