EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12N2O2 |
| Net Charge | 0 |
| Average Mass | 252.273 |
| Monoisotopic Mass | 252.08988 |
| SMILES | O=C1NC(=O)C(c2ccccc2)(c2ccccc2)N1 |
| InChI | InChI=1S/C15H12N2O2/c18-13-15(17-14(19)16-13,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H2,16,17,18,19) |
| InChIKey | CXOFVDLJLONNDW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. drug allergen Any drug which causes the onset of an allergic reaction. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenytoin (CHEBI:8107) has functional parent hydantoin (CHEBI:27612) |
| phenytoin (CHEBI:8107) has role anticonvulsant (CHEBI:35623) |
| phenytoin (CHEBI:8107) has role drug allergen (CHEBI:88188) |
| phenytoin (CHEBI:8107) has role sodium channel blocker (CHEBI:38633) |
| phenytoin (CHEBI:8107) has role teratogenic agent (CHEBI:50905) |
| phenytoin (CHEBI:8107) is a imidazolidine-2,4-dione (CHEBI:24628) |
| IUPAC Name |
|---|
| 5,5-diphenylimidazolidine-2,4-dione |
| INNs | Source |
|---|---|
| fenitoina | ChemIDplus |
| phenytoin | ChemIDplus |
| phenytoine | ChemIDplus |
| phenytoinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5,5-diphenylimidazolidine-2,4-dione | ChEMBL |
| 5,5-Diphenyl-imidazolidine-2,4-dione | ChEMBL |
| 5,5-diphenyltetrahydro-1H-2,4-imidazoledione | ChEMBL |
| DILANTIN | ChEMBL |
| PHENTYTOIN | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2152 | DrugCentral |
| C07443 | KEGG COMPOUND |
| D00512 | KEGG DRUG |
| DB00252 | DrugBank |
| HMDB0014397 | HMDB |
| LSM-5663 | LINCS |
| Phenytoin | Wikipedia |
| WO2012174723 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:384532 | Reaxys |
| CAS:57-41-0 | KEGG COMPOUND |
| CAS:57-41-0 | ChemIDplus |
| Citations |
|---|