EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12N2O2 |
| Net Charge | 0 |
| Average Mass | 252.273 |
| Monoisotopic Mass | 252.08988 |
| SMILES | O=C1NC(=O)C(c2ccccc2)(c2ccccc2)N1 |
| InChI | InChI=1S/C15H12N2O2/c18-13-15(17-14(19)16-13,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H2,16,17,18,19) |
| InChIKey | CXOFVDLJLONNDW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. anticonvulsant A drug used to prevent seizures or reduce their severity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenytoin (CHEBI:8107) has functional parent hydantoin (CHEBI:27612) |
| phenytoin (CHEBI:8107) has role anticonvulsant (CHEBI:35623) |
| phenytoin (CHEBI:8107) has role drug allergen (CHEBI:88188) |
| phenytoin (CHEBI:8107) has role sodium channel blocker (CHEBI:38633) |
| phenytoin (CHEBI:8107) has role teratogenic agent (CHEBI:50905) |
| phenytoin (CHEBI:8107) is a imidazolidine-2,4-dione (CHEBI:24628) |
| IUPAC Name |
|---|
| 5,5-diphenylimidazolidine-2,4-dione |
| INNs | Source |
|---|---|
| fenitoina | ChemIDplus |
| phenytoin | ChemIDplus |
| phenytoine | ChemIDplus |
| phenytoinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5,5-diphenylimidazolidine-2,4-dione | ChEMBL |
| 5,5-Diphenyl-imidazolidine-2,4-dione | ChEMBL |
| 5,5-diphenyltetrahydro-1H-2,4-imidazoledione | ChEMBL |
| DILANTIN | ChEMBL |
| PHENTYTOIN | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2152 | DrugCentral |
| C07443 | KEGG COMPOUND |
| D00512 | KEGG DRUG |
| DB00252 | DrugBank |
| HMDB0014397 | HMDB |
| LSM-5663 | LINCS |
| Phenytoin | Wikipedia |
| WO2012174723 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:384532 | Reaxys |
| CAS:57-41-0 | KEGG COMPOUND |
| CAS:57-41-0 | ChemIDplus |
| Citations |
|---|