EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12N2O2 |
| Net Charge | 0 |
| Average Mass | 252.273 |
| Monoisotopic Mass | 252.08988 |
| SMILES | O=C1NC(=O)C(c2ccccc2)(c2ccccc2)N1 |
| InChI | InChI=1S/C15H12N2O2/c18-13-15(17-14(19)16-13,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H2,16,17,18,19) |
| InChIKey | CXOFVDLJLONNDW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. sodium channel blocker An agent that inhibits sodium influx through cell membranes. drug allergen Any drug which causes the onset of an allergic reaction. |
| Applications: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anticonvulsant A drug used to prevent seizures or reduce their severity. anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. vulnerary A drug used in treating and healing of wounds. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenytoin (CHEBI:8107) has functional parent hydantoin (CHEBI:27612) |
| phenytoin (CHEBI:8107) has role anti-anaemic agent (CHEBI:75835) |
| phenytoin (CHEBI:8107) has role anticonvulsant (CHEBI:35623) |
| phenytoin (CHEBI:8107) has role antidepressant (CHEBI:35469) |
| phenytoin (CHEBI:8107) has role antineoplastic agent (CHEBI:35610) |
| phenytoin (CHEBI:8107) has role antipsychotic agent (CHEBI:35476) |
| phenytoin (CHEBI:8107) has role anxiolytic drug (CHEBI:35474) |
| phenytoin (CHEBI:8107) has role drug allergen (CHEBI:88188) |
| phenytoin (CHEBI:8107) has role sodium channel blocker (CHEBI:38633) |
| phenytoin (CHEBI:8107) has role teratogenic agent (CHEBI:50905) |
| phenytoin (CHEBI:8107) has role vulnerary (CHEBI:73336) |
| phenytoin (CHEBI:8107) is a imidazolidine-2,4-dione (CHEBI:24628) |
| IUPAC Name |
|---|
| 5,5-diphenylimidazolidine-2,4-dione |
| INNs | Source |
|---|---|
| fenitoina | ChemIDplus |
| phenytoin | ChemIDplus |
| phenytoine | ChemIDplus |
| phenytoinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5,5-diphenylimidazolidine-2,4-dione | ChEMBL |
| 5,5-Diphenyl-imidazolidine-2,4-dione | ChEMBL |
| 5,5-diphenyltetrahydro-1H-2,4-imidazoledione | ChEMBL |
| DILANTIN | ChEMBL |
| Epamin | ChEMBL |
| Lepitoin | ChEMBL |
| Brand Names | Source |
|---|---|
| Dilabid | ChEMBL |
| Dilantin-125 | ChEMBL |
| Dilantin-30 | ChEMBL |
| Hydantol | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 2152 | DrugCentral |
| C07443 | KEGG COMPOUND |
| D00512 | KEGG DRUG |
| DB00252 | DrugBank |
| HMDB0014397 | HMDB |
| LSM-5663 | LINCS |
| Phenytoin | Wikipedia |
| WO2012174723 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:384532 | Reaxys |
| CAS:57-41-0 | KEGG COMPOUND |
| CAS:57-41-0 | ChemIDplus |
| Citations |
|---|