EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H26N2O4S |
| Net Charge | 0 |
| Average Mass | 342.461 |
| Monoisotopic Mass | 342.16133 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)CCCCCCC |
| InChI | InChI=1S/C16H26N2O4S/c1-4-5-6-7-8-9-10(19)17-11-13(20)18-12(15(21)22)16(2,3)23-14(11)18/h11-12,14H,4-9H2,1-3H3,(H,17,19)(H,21,22)/t11-,12+,14-/m1/s1 |
| InChIKey | XVASOOUVMJAZNJ-MBNYWOFBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penicillin K (CHEBI:81064) is a penicillin (CHEBI:17334) |
| Synonym | Source |
|---|---|
| Penicillin A | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17403 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:525-97-3 | KEGG COMPOUND |