EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2O4S |
| Net Charge | 0 |
| Average Mass | 312.391 |
| Monoisotopic Mass | 312.11438 |
| SMILES | [H][C@]12SC(C)(C)[C@H](C(=O)O)N1C(=O)[C@H]2NC(=O)C/C=C/CC |
| InChI | InChI=1S/C14H20N2O4S/c1-4-5-6-7-8(17)15-9-11(18)16-10(13(19)20)14(2,3)21-12(9)16/h5-6,9-10,12H,4,7H2,1-3H3,(H,15,17)(H,19,20)/b6-5+/t9-,10+,12-/m1/s1 |
| InChIKey | QRLCJUNAKLMRGP-ZTWGYATJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Penicillin F (CHEBI:81063) is a penicillin (CHEBI:17334) |
| Synonym | Source |
|---|---|
| 2-Pentenylpenicillin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17402 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:118-53-6 | KEGG COMPOUND |