EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O8S2 |
| Net Charge | 0 |
| Average Mass | 394.427 |
| Monoisotopic Mass | 394.05046 |
| SMILES | [H][C@@]1([C@H](C)OS(=O)(=O)O)C(=O)N2C(C(=O)O)=C(SCCNC(C)=O)C[C@@]21[H] |
| InChI | InChI=1S/C13H18N2O8S2/c1-6(23-25(20,21)22)10-8-5-9(24-4-3-14-7(2)16)11(13(18)19)15(8)12(10)17/h6,8,10H,3-5H2,1-2H3,(H,14,16)(H,18,19)(H,20,21,22)/t6-,8+,10-/m0/s1 |
| InChIKey | HZYSJDYRQDXUAB-IONOHQLYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Epithienamycin F (CHEBI:81061) is a carbapenems (CHEBI:46633) |
| Manual Xrefs | Databases |
|---|---|
| C17399 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:79057-45-7 | KEGG COMPOUND |