EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H35N3O8S |
| Net Charge | 0 |
| Average Mass | 489.591 |
| Monoisotopic Mass | 489.21449 |
| SMILES | [H][C@]12C[C@H](SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO)[C@H](C(=O)O)N1C(=O)[C@@]2([H])C(C)(C)O |
| InChI | InChI=1S/C21H35N3O8S/c1-20(2,10-25)16(27)17(28)23-6-5-13(26)22-7-8-33-12-9-11-14(21(3,4)32)18(29)24(11)15(12)19(30)31/h11-12,14-16,25,27,32H,5-10H2,1-4H3,(H,22,26)(H,23,28)(H,30,31)/t11-,12+,14+,15-,16+/m1/s1 |
| InChIKey | NSMABMGRXUKVDE-IVCRCZCHSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| OA-6129 E (CHEBI:81043) is a carbapenems (CHEBI:46633) |
| Manual Xrefs | Databases |
|---|---|
| C17376 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:85414-26-2 | KEGG COMPOUND |