EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33N3O8S |
| Net Charge | 0 |
| Average Mass | 475.564 |
| Monoisotopic Mass | 475.19884 |
| SMILES | [H][C@@]1(C(C)O)C(=O)N2[C@@H](C(=O)O)[C@@H](SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO)C[C@@]21[H] |
| InChI | InChI=1S/C20H33N3O8S/c1-10(25)14-11-8-12(15(19(30)31)23(11)18(14)29)32-7-6-21-13(26)4-5-22-17(28)16(27)20(2,3)9-24/h10-12,14-16,24-25,27H,4-9H2,1-3H3,(H,21,26)(H,22,28)(H,30,31)/t10?,11-,12+,14+,15-,16+/m1/s1 |
| InChIKey | IDHUQZYNJINFBS-VWLVWCDXSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| OA-6129 D (CHEBI:81042) is a carbapenems (CHEBI:46633) |
| IUPAC Name |
|---|
| (2S,3S,5R,6R)-3-{[2-({N-[(2R)-2,4-dihydroxy-3,3-dimethylbutanoyl]-β-alanyl}amino)ethyl]sulfanyl}-6-(1-hydroxyethyl)-7-oxo-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| C17375 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:85414-25-1 | KEGG COMPOUND |