EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H31N3O8S |
| Net Charge | 0 |
| Average Mass | 473.548 |
| Monoisotopic Mass | 473.18319 |
| SMILES | [H][C@]12CC(SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)CO)=C(C(=O)O)N1C(=O)[C@]2([H])[C@H](C)O |
| InChI | InChI=1S/C20H31N3O8S/c1-10(25)14-11-8-12(15(19(30)31)23(11)18(14)29)32-7-6-21-13(26)4-5-22-17(28)16(27)20(2,3)9-24/h10-11,14,16,24-25,27H,4-9H2,1-3H3,(H,21,26)(H,22,28)(H,30,31)/t10-,11+,14+,16-/m0/s1 |
| InChIKey | HNLNYXRYILRJHY-CIGZNWKYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| OA-6129 B2 (CHEBI:81041) is a carbapenems (CHEBI:46633) |
| Manual Xrefs | Databases |
|---|---|
| C17374 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:82475-10-3 | KEGG COMPOUND |