EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO |
| Net Charge | 0 |
| Average Mass | 151.209 |
| Monoisotopic Mass | 151.09971 |
| SMILES | C[C@@H](N)[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C9H13NO/c1-7(10)9(11)8-5-3-2-4-6-8/h2-7,9,11H,10H2,1H3/t7-,9+/m1/s1 |
| InChIKey | DLNKOYKMWOXYQA-APPZFPTMSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. |
| Applications: | nasal decongestant A drug used to relieve nasal congestion in the upper respiratory tract. sympathomimetic agent A drug that mimics the effects of stimulating postganglionic adrenergic sympathetic nerves. Included in this class are drugs that directly stimulate adrenergic receptors and drugs that act indirectly by provoking the release of adrenergic transmitters. central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenylpropanolamine (CHEBI:8104) has role nasal decongestant (CHEBI:77715) |
| phenylpropanolamine (CHEBI:8104) has role sympathomimetic agent (CHEBI:35524) |
| phenylpropanolamine (CHEBI:8104) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| (1R,2R)-2-amino-1-phenylpropan-1-ol |
| INNs | Source |
|---|---|
| fenilpropanolamina | WHO MedNet |
| phenylpropanolamine | ChemIDplus |
| phénylpropanolamine | WHO MedNet |
| phenylpropanolaminum | WHO MedNet |
| Synonyms | Source |
|---|---|
| norephedrine | ChemIDplus |
| PPA | DrugBank |
| β-hydroxyamphetamine | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3196918 | Reaxys |
| CAS:14838-15-4 | KEGG DRUG |
| CAS:14838-15-4 | ChemIDplus |
| Citations |
|---|