EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O5S |
| Net Charge | 0 |
| Average Mass | 314.363 |
| Monoisotopic Mass | 314.09364 |
| SMILES | [H][C@@]1([C@H](C)O)C(=O)N2C(C(=O)O)=C(SCCNC(C)=O)C[C@@]21[H] |
| InChI | InChI=1S/C13H18N2O5S/c1-6(16)10-8-5-9(21-4-3-14-7(2)17)11(13(19)20)15(8)12(10)18/h6,8,10,16H,3-5H2,1-2H3,(H,14,17)(H,19,20)/t6-,8+,10-/m0/s1 |
| InChIKey | VUDXUIMGYZQRKK-IONOHQLYSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Epithienamycin A (CHEBI:81039) is a carbapenems (CHEBI:46633) |
| Manual Xrefs | Databases |
|---|---|
| C17372 | KEGG COMPOUND |