EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2O4S |
| Net Charge | 0 |
| Average Mass | 312.391 |
| Monoisotopic Mass | 312.11438 |
| SMILES | [H][C@]12CC(SCCNC(C)=O)=C(C(=O)O)N1C(=O)[C@@H]2C(C)C |
| InChI | InChI=1S/C14H20N2O4S/c1-7(2)11-9-6-10(21-5-4-15-8(3)17)12(14(19)20)16(9)13(11)18/h7,9,11H,4-6H2,1-3H3,(H,15,17)(H,19,20)/t9-,11-/m1/s1 |
| InChIKey | SUMQHCXEWHRKGG-MWLCHTKSSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PS-6 (CHEBI:81038) is a carbapenems (CHEBI:46633) |
| Synonym | Source |
|---|---|
| Antibiotic PS 6 | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17371 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:72615-19-1 | KEGG COMPOUND |