EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14N2O4S |
| Net Charge | 0 |
| Average Mass | 258.299 |
| Monoisotopic Mass | 258.06743 |
| SMILES | [H][C@]12CC(SCCN)=C(C(=O)O)N1C(=O)[C@@H]2CO |
| InChI | InChI=1S/C10H14N2O4S/c11-1-2-17-7-3-6-5(4-13)9(14)12(6)8(7)10(15)16/h5-6,13H,1-4,11H2,(H,15,16)/t5-,6-/m1/s1 |
| InChIKey | CORBMZCTOZNVHZ-PHDIDXHHSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Northienamycin (CHEBI:81036) is a carbapenems (CHEBI:46633) |
| Manual Xrefs | Databases |
|---|---|
| C17369 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:77550-86-8 | KEGG COMPOUND |