EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16N2O3S |
| Net Charge | 0 |
| Average Mass | 256.327 |
| Monoisotopic Mass | 256.08816 |
| SMILES | [H][C@]12CC(SCCN)=C(C(=O)O)N1C(=O)[C@@H]2CC |
| InChI | InChI=1S/C11H16N2O3S/c1-2-6-7-5-8(17-4-3-12)9(11(15)16)13(7)10(6)14/h6-7H,2-5,12H2,1H3,(H,15,16)/t6-,7-/m1/s1 |
| InChIKey | PSJNLRROOZKIHF-RNFRBKRXSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NS-5 (CHEBI:81035) is a carbapenems (CHEBI:46633) |
| Synonyms | Source |
|---|---|
| 8-Dehydroxythienamycin | KEGG COMPOUND |
| 8-Deshydroxythienamycin | KEGG COMPOUND |
| Deshydroxythienamycin | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17368 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:74806-75-0 | KEGG COMPOUND |