EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H11NO3 |
| Net Charge | 0 |
| Average Mass | 157.169 |
| Monoisotopic Mass | 157.07389 |
| SMILES | [H][C@]12CC(=O)N1C[C@H](CCO)O2 |
| InChI | InChI=1S/C7H11NO3/c9-2-1-5-4-8-6(10)3-7(8)11-5/h5,7,9H,1-4H2/t5-,7-/m0/s1 |
| InChIKey | UEGDICIJUUEIOL-FSPLSTOPSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Hydroxyethylclavam (CHEBI:81030) is a penams (CHEBI:35992) |
| Synonym | Source |
|---|---|
| Hydroxyethylclavam | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17361 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:79416-52-7 | KEGG COMPOUND |