EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H9NO4 |
| Net Charge | 0 |
| Average Mass | 171.152 |
| Monoisotopic Mass | 171.05316 |
| SMILES | [H]C(=O)OC[C@H]1CN2C(=O)C[C@]2([H])O1 |
| InChI | InChI=1S/C7H9NO4/c9-4-11-3-5-2-8-6(10)1-7(8)12-5/h4-5,7H,1-3H2/t5-,7+/m1/s1 |
| InChIKey | CFRVNACMJWVDID-VDTYLAMSSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Formyloxymethylclavam (CHEBI:81025) is a penams (CHEBI:35992) |
| Manual Xrefs | Databases |
|---|---|
| C17356 | KEGG COMPOUND |