EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23N3O9 |
| Net Charge | 0 |
| Average Mass | 485.449 |
| Monoisotopic Mass | 485.14343 |
| SMILES | N[C@H](CCOc1ccc(C(=O)C(=O)N[C@H]2CN([C@@H](C(=O)O)c3ccc(O)cc3)C2=O)cc1)C(=O)O |
| InChI | InChI=1S/C23H23N3O9/c24-16(22(31)32)9-10-35-15-7-3-13(4-8-15)19(28)20(29)25-17-11-26(21(17)30)18(23(33)34)12-1-5-14(27)6-2-12/h1-8,16-18,27H,9-11,24H2,(H,25,29)(H,31,32)(H,33,34)/t16-,17+,18-/m1/s1 |
| InChIKey | QJZHIGKJGFPGRN-FGTMMUONSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nocardicin D (CHEBI:81023) is a monobactam (CHEBI:50695) |
| Manual Xrefs | Databases |
|---|---|
| C17353 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:61425-17-0 | KEGG COMPOUND |