EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24N4O9 |
| Net Charge | 0 |
| Average Mass | 500.464 |
| Monoisotopic Mass | 500.15433 |
| SMILES | N[C@H](CCOc1ccc(/C(=N\O)C(=O)N[C@H]2CN([C@@H](C(=O)O)c3ccc(O)cc3)C2=O)cc1)C(=O)O |
| InChI | InChI=1S/C23H24N4O9/c24-16(22(31)32)9-10-36-15-7-3-12(4-8-15)18(26-35)20(29)25-17-11-27(21(17)30)19(23(33)34)13-1-5-14(28)6-2-13/h1-8,16-17,19,28,35H,9-11,24H2,(H,25,29)(H,31,32)(H,33,34)/b26-18+/t16-,17+,19-/m1/s1 |
| InChIKey | CTNZOGJNVIFEBA-TWTPMLPMSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nocardicin B (CHEBI:81020) is a monobactam (CHEBI:50695) |
| Manual Xrefs | Databases |
|---|---|
| C17350 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:60134-71-6 | KEGG COMPOUND |