EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19NO10S2 |
| Net Charge | 0 |
| Average Mass | 377.393 |
| Monoisotopic Mass | 377.04504 |
| SMILES | CC(CO)C(=NOS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C10H19NO10S2/c1-4(2-12)9(11-21-23(17,18)19)22-10-8(16)7(15)6(14)5(3-13)20-10/h4-8,10,12-16H,2-3H2,1H3,(H,17,18,19)/t4?,5-,6-,7+,8-,10+/m1/s1 |
| InChIKey | WMJAKSMGNADDKY-QTCACZPWSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glucosisymbrin (CHEBI:81002) is a glucosinolic acid (CHEBI:79316) |
| Synonym | Source |
|---|---|
| 1-Methyl-2-hydroxyetyl glucosinolate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17275 | KEGG COMPOUND |