EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO10S2 |
| Net Charge | 0 |
| Average Mass | 439.464 |
| Monoisotopic Mass | 439.06069 |
| SMILES | O=S(=O)(O)ON=C(CC(O)c1ccccc1)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H21NO10S2/c17-7-10-12(19)13(20)14(21)15(25-10)27-11(16-26-28(22,23)24)6-9(18)8-4-2-1-3-5-8/h1-5,9-10,12-15,17-21H,6-7H2,(H,22,23,24)/t9?,10-,12-,13+,14-,15+/m1/s1 |
| InChIKey | GAPDDBFHNYHZIS-LNUNAXHXSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glucobarbarin (CHEBI:81001) is a glucosinolic acid (CHEBI:79316) |
| Synonym | Source |
|---|---|
| 2(R)-Hydroxy-2-phenylethyl glucosinolate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17274 | KEGG COMPOUND |