EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H31NO10S3 |
| Net Charge | 0 |
| Average Mass | 493.622 |
| Monoisotopic Mass | 493.11101 |
| SMILES | CS(=O)CCCCCCCC/C(=N/OS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H31NO10S3/c1-29(22)9-7-5-3-2-4-6-8-12(17-27-30(23,24)25)28-16-15(21)14(20)13(19)11(10-18)26-16/h11,13-16,18-21H,2-10H2,1H3,(H,23,24,25)/b17-12-/t11-,13-,14+,15-,16+,29?/m1/s1 |
| InChIKey | GPMDJOOLATZDQL-OTNWBXTQSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glucohirsutin (CHEBI:80998) is a glucosinolic acid (CHEBI:79316) |
| Glucohirsutin (CHEBI:80998) is a sulfoxide (CHEBI:22063) |
| Synonyms | Source |
|---|---|
| 8-Methylsulfinyloctyl glucosinolate | KEGG COMPOUND |
| 8-MethylsulfinyloctylGS | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C17271 | KEGG COMPOUND |