EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H31NO9S3 |
| Net Charge | 0 |
| Average Mass | 477.623 |
| Monoisotopic Mass | 477.11609 |
| SMILES | CSCCCCCCCCC(=NOS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H31NO9S3/c1-27-9-7-5-3-2-4-6-8-12(17-26-29(22,23)24)28-16-15(21)14(20)13(19)11(10-18)25-16/h11,13-16,18-21H,2-10H2,1H3,(H,22,23,24)/t11-,13-,14+,15-,16+/m1/s1 |
| InChIKey | CWOJBEDMJKZKAB-JZYAIQKZSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-Methylthiooctyl glucosinolate (CHEBI:80989) is a glucosinolate (CHEBI:24279) |
| Manual Xrefs | Databases |
|---|---|
| C17254 | KEGG COMPOUND |