EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H29NO9S3 |
| Net Charge | 0 |
| Average Mass | 463.596 |
| Monoisotopic Mass | 463.10044 |
| SMILES | CSCCCCCCCC(=NOS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C15H29NO9S3/c1-26-8-6-4-2-3-5-7-11(16-25-28(21,22)23)27-15-14(20)13(19)12(18)10(9-17)24-15/h10,12-15,17-20H,2-9H2,1H3,(H,21,22,23)/t10-,12-,13+,14-,15+/m1/s1 |
| InChIKey | SJHVRBSHKTUXLG-LFHLZQBKSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 7-Methylthioheptyl glucosinolate (CHEBI:80988) is a glucosinolate (CHEBI:24279) |
| Manual Xrefs | Databases |
|---|---|
| C17252 | KEGG COMPOUND |