EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H27NO9S3 |
| Net Charge | 0 |
| Average Mass | 449.569 |
| Monoisotopic Mass | 449.08479 |
| SMILES | CSCCCCCCC(=NOS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H27NO9S3/c1-25-7-5-3-2-4-6-10(15-24-27(20,21)22)26-14-13(19)12(18)11(17)9(8-16)23-14/h9,11-14,16-19H,2-8H2,1H3,(H,20,21,22)/t9-,11-,12+,13-,14+/m1/s1 |
| InChIKey | ZAKICGFSIJSCSF-LPUQOGTASA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glucolesquerellin (CHEBI:80987) is a glucosinolic acid (CHEBI:79316) |
| Synonym | Source |
|---|---|
| 6-Methylthiohexyl glucosinolate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C17250 | KEGG COMPOUND |