EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H14N2O4S |
| Net Charge | 0 |
| Average Mass | 270.310 |
| Monoisotopic Mass | 270.06743 |
| SMILES | N[C@@H](CS/C(Cc1ccc(O)cc1)=N\O)C(=O)O |
| InChI | InChI=1S/C11H14N2O4S/c12-9(11(15)16)6-18-10(13-17)5-7-1-3-8(14)4-2-7/h1-4,9,14,17H,5-6,12H2,(H,15,16)/b13-10-/t9-/m0/s1 |
| InChIKey | ACNQSIOMZUBKCK-FWSONLODSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(Hydroxyphenylacetothiohydroximoyl)-L-cysteine (CHEBI:80980) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Manual Xrefs | Databases |
|---|---|
| C17238 | KEGG COMPOUND |