EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H4N2O3 |
| Net Charge | 0 |
| Average Mass | 140.098 |
| Monoisotopic Mass | 140.02219 |
| SMILES | O=Cc1cnc(=O)nc1=O |
| InChI | InChI=1S/C5H4N2O3/c8-2-3-1-6-5(10)7-4(3)9/h1-2H,(H2,6,7,9,10) |
| InChIKey | OHAMXGZMZZWRCA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). mutagen An agent that increases the frequency of mutations above the normal background level, usually by interacting directly with DNA and causing it damage, including base substitution. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-formyluracil (CHEBI:80961) has functional parent 5-hydroxymethyluracil (CHEBI:16964) |
| 5-formyluracil (CHEBI:80961) has functional parent thymine (CHEBI:17821) |
| 5-formyluracil (CHEBI:80961) has role human metabolite (CHEBI:77746) |
| 5-formyluracil (CHEBI:80961) has role mutagen (CHEBI:25435) |
| 5-formyluracil (CHEBI:80961) is a aldehyde (CHEBI:17478) |
| 5-formyluracil (CHEBI:80961) is a nucleobase analogue (CHEBI:67142) |
| 5-formyluracil (CHEBI:80961) is a pyrimidone (CHEBI:38337) |
| IUPAC Name |
|---|
| 2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbaldehyde |
| Synonyms | Source |
|---|---|
| 2,4-dioxo-1,2,3,4-tetrahydro-5-pyrimidinecarbaldehyde | ChEBI |
| 5fU | ChEBI |
| FoU | ChEBI |
| uracil 5-carbaldehyde | KEGG COMPOUND |
| uracil-5-carboxaldehyde | ChEBI |
| UniProt Name | Source |
|---|---|
| 5-formyluracil | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 5-Formyluracil | Wikipedia |
| C17206 | KEGG COMPOUND |
| FYU | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Reaxys:125791 | Reaxys |
| CAS:1195-08-0 | KEGG COMPOUND |
| CAS:1195-08-0 | ChemIDplus |
| Citations |
|---|