EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16BrN3O2S |
| Net Charge | 0 |
| Average Mass | 370.272 |
| Monoisotopic Mass | 369.01466 |
| SMILES | [H][C@]12c3nc4cc(Br)c(O)cc4c3CCN1OCSC[C@H]2N |
| InChI | InChI=1S/C14H16BrN3O2S/c15-9-4-11-8(3-12(9)19)7-1-2-18-14(13(7)17-11)10(16)5-21-6-20-18/h3-4,10,14,17,19H,1-2,5-6,16H2/t10-,14+/m1/s1 |
| InChIKey | XHYJPORPMFTSBP-YGRLFVJLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eudistoma olivaceum (ncbitaxon:1331021) | - | DOI (10.1021/ja00317a079) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. antiviral agent A substance that destroys or inhibits replication of viruses. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eudistomin C (CHEBI:80955) has role animal metabolite (CHEBI:75767) |
| eudistomin C (CHEBI:80955) has role antineoplastic agent (CHEBI:35610) |
| eudistomin C (CHEBI:80955) has role antiviral agent (CHEBI:22587) |
| eudistomin C (CHEBI:80955) has role marine metabolite (CHEBI:76507) |
| eudistomin C (CHEBI:80955) has role protein synthesis inhibitor (CHEBI:48001) |
| eudistomin C (CHEBI:80955) is a indole alkaloid (CHEBI:38958) |
| eudistomin C (CHEBI:80955) is a organic heterotetracyclic compound (CHEBI:38163) |
| eudistomin C (CHEBI:80955) is a organobromine compound (CHEBI:37141) |
| eudistomin C (CHEBI:80955) is a phenols (CHEBI:33853) |
| eudistomin C (CHEBI:80955) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| (1S,13bS)-1-amino-11-bromo-1,2,7,8,13,13b-hexahydro[1,6,2]oxathiazepino[2',3':1,2]pyrido[3,4-b]indol-10-ol |
| Synonyms | Source |
|---|---|
| (−)-eudistomine C | ChEBI |
| eudistomine C | ChemIDplus |
| (−)-eudistomin C | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:88704-50-1 | ChemIDplus |
| Citations |
|---|