EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16BrN3O2S |
| Net Charge | 0 |
| Average Mass | 370.272 |
| Monoisotopic Mass | 369.01466 |
| SMILES | [H][C@]12c3nc4cc(Br)c(O)cc4c3CCN1OCSC[C@H]2N |
| InChI | InChI=1S/C14H16BrN3O2S/c15-9-4-11-8(3-12(9)19)7-1-2-18-14(13(7)17-11)10(16)5-21-6-20-18/h3-4,10,14,17,19H,1-2,5-6,16H2/t10-,14+/m1/s1 |
| InChIKey | XHYJPORPMFTSBP-YGRLFVJLSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Eudistoma olivaceum (ncbitaxon:1331021) | - | DOI (10.1021/ja00317a079) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. antiviral agent A substance that destroys or inhibits replication of viruses. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eudistomin C (CHEBI:80955) has role animal metabolite (CHEBI:75767) |
| eudistomin C (CHEBI:80955) has role antineoplastic agent (CHEBI:35610) |
| eudistomin C (CHEBI:80955) has role antiviral agent (CHEBI:22587) |
| eudistomin C (CHEBI:80955) has role marine metabolite (CHEBI:76507) |
| eudistomin C (CHEBI:80955) has role protein synthesis inhibitor (CHEBI:48001) |
| eudistomin C (CHEBI:80955) is a indole alkaloid (CHEBI:38958) |
| eudistomin C (CHEBI:80955) is a organic heterotetracyclic compound (CHEBI:38163) |
| eudistomin C (CHEBI:80955) is a organobromine compound (CHEBI:37141) |
| eudistomin C (CHEBI:80955) is a phenols (CHEBI:33853) |
| eudistomin C (CHEBI:80955) is a primary amino compound (CHEBI:50994) |
| IUPAC Name |
|---|
| (1S,13bS)-1-amino-11-bromo-1,2,7,8,13,13b-hexahydro[1,6,2]oxathiazepino[2',3':1,2]pyrido[3,4-b]indol-10-ol |
| Synonyms | Source |
|---|---|
| (−)-eudistomin C | ChEBI |
| (−)-eudistomine C | ChEBI |
| eudistomine C | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:88704-50-1 | ChemIDplus |
| Citations |
|---|