EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16343 - phenylethanolamine
| Formula | C8H11NO |
| Net Charge | 0 |
| Average Mass | 137.182 |
| Monoisotopic Mass | 137.08406 |
| SMILES | NCC(O)c1ccccc1 |
| InChI | InChI=1S/C8H11NO/c9-6-8(10)7-4-2-1-3-5-7/h1-5,8,10H,6,9H2 |
| InChIKey | ULSIYEODSMZIPX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | PubMed (3137238) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenylethanolamine (CHEBI:16343) has role human metabolite (CHEBI:77746) |
| phenylethanolamine (CHEBI:16343) is a phenylethanolamines (CHEBI:25990) |
| phenylethanolamine (CHEBI:16343) is conjugate base of phenylethanolaminium (CHEBI:57741) |
| Incoming Relation(s) |
| 2-(hydroxymethyl)-4-(1-hydroxy-2-{[6-(4-phenylbutoxy)hexyl]amino}ethyl)phenol (CHEBI:64064) has functional parent phenylethanolamine (CHEBI:16343) |
| phenylethanolaminium (CHEBI:57741) is conjugate acid of phenylethanolamine (CHEBI:16343) |
| IUPAC Name |
|---|
| 2-amino-1-phenylethanol |
| Synonyms | Source |
|---|---|
| Phenylethanolamine | KEGG COMPOUND |
| 2-Amino-1-phenylethanol | KEGG COMPOUND |
| 2-amino-1-phenylethanol | ChEBI |
| 2-Hydroxy-2-phenylethylamine | ChemIDplus |
| 2-Phenyl-2-hydroxyethylamine | ChemIDplus |
| 2-Hydroxyphenethylamine | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C02735 | KEGG COMPOUND |
| HMDB0001065 | HMDB |
| Phenylethanolamine | Wikipedia |
| PHENYLETHANOLAMINE | MetaCyc |
| 3460 | DrugCentral |
| Citations |
|---|